C7H13F3N2O2S — CID 112684331
1-(sulfamoylamino)-4-(trifluoromethyl)cyclohexane (PubChem CID 112684331) has the molecular formula C7H13F3N2O2S and a molecular weight of 246.25 g/mol. Its IUPAC name is 1-(sulfamoylamino)-4-(trifluoromethyl)cyclohexane.
| Compound Name | 1-(sulfamoylamino)-4-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 112684331 |
| Molecular Formula | C7H13F3N2O2S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-(sulfamoylamino)-4-(trifluoromethyl)cyclohexane |
| SMILES | NS(=O)(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H13F3N2O2S/c8-7(9,10)5-1-3-6(4-2-5)12-15(11,13)14/h5-6,12H,1-4H2,(H2,11,13,14) |
| InChIKey | WQLOYDMJOWKLBR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |