C7H12F2LiNO3S — CID 156663503
lithium N-[(4,4-difluorocyclohexyl)methyl]sulfamate (PubChem CID 156663503) has the molecular formula C7H12F2LiNO3S and a molecular weight of 235.18 g/mol. Its IUPAC name is lithium N-[(4,4-difluorocyclohexyl)methyl]sulfamate.
| Compound Name | lithium N-[(4,4-difluorocyclohexyl)methyl]sulfamate |
|---|---|
| PubChem CID | 156663503 |
| Molecular Formula | C7H12F2LiNO3S |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | lithium N-[(4,4-difluorocyclohexyl)methyl]sulfamate |
| SMILES | O=S(=O)([O-])NCC1CCC(F)(F)CC1.[Li+] |
| InChI | InChI=1S/C7H13F2NO3S.Li/c8-7(9)3-1-6(2-4-7)5-10-14(11,12)13;/h6,10H,1-5H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | LKVGRQRLKKXUNT-UHFFFAOYSA-M |
| XLogP | -2.13 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|