C7H13F2NO3S — CID 156663504
(4,4-difluorocyclohexyl)methylsulfamic acid (PubChem CID 156663504) has the molecular formula C7H13F2NO3S and a molecular weight of 229.25 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methylsulfamic acid.
| Compound Name | (4,4-difluorocyclohexyl)methylsulfamic acid |
|---|---|
| PubChem CID | 156663504 |
| Molecular Formula | C7H13F2NO3S |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | (4,4-difluorocyclohexyl)methylsulfamic acid |
| SMILES | O=S(=O)(O)NCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H13F2NO3S/c8-7(9)3-1-6(2-4-7)5-10-14(11,12)13/h6,10H,1-5H2,(H,11,12,13) |
| InChIKey | LVOLFLYMCUUIFM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|