C12H14N2O4S — CID 112684914
N-[4-(cyanomethoxy)phenyl]-2-methylsulfonylpropanamide (PubChem CID 112684914) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is N-[4-(cyanomethoxy)phenyl]-2-methylsulfonylpropanamide.
| Compound Name | N-[4-(cyanomethoxy)phenyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 112684914 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-[4-(cyanomethoxy)phenyl]-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1ccc(OCC#N)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C12H14N2O4S/c1-9(19(2,16)17)12(15)14-10-3-5-11(6-4-10)18-8-7-13/h3-6,9H,8H2,1-2H3,(H,14,15) |
| InChIKey | DRTPUPVONZSZEL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |