C9H8F2N2O3S — CID 43175608
N-[4-(cyanomethoxy)phenyl]-1,1-difluoromethanesulfonamide (PubChem CID 43175608) has the molecular formula C9H8F2N2O3S and a molecular weight of 262.24 g/mol. Its IUPAC name is N-[4-(cyanomethoxy)phenyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[4-(cyanomethoxy)phenyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 43175608 |
| Molecular Formula | C9H8F2N2O3S |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | N-[4-(cyanomethoxy)phenyl]-1,1-difluoromethanesulfonamide |
| SMILES | N#CCOc1ccc(NS(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C9H8F2N2O3S/c10-9(11)17(14,15)13-7-1-3-8(4-2-7)16-6-5-12/h1-4,9,13H,6H2 |
| InChIKey | QUVUAGIKWQDZPF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |