C9H21N3O2S — CID 112686118
1-tert-butyl-4-(sulfamoylamino)piperidine (PubChem CID 112686118) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-tert-butyl-4-(sulfamoylamino)piperidine.
| Compound Name | 1-tert-butyl-4-(sulfamoylamino)piperidine |
|---|---|
| PubChem CID | 112686118 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-tert-butyl-4-(sulfamoylamino)piperidine |
| SMILES | CC(C)(C)N1CCC(NS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C9H21N3O2S/c1-9(2,3)12-6-4-8(5-7-12)11-15(10,13)14/h8,11H,4-7H2,1-3H3,(H2,10,13,14) |
| InChIKey | WHJDIVOHSXMLMI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |