C19H21F4N5O — CID 1126903
[(5S,7R)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 1126903) has the molecular formula C19H21F4N5O and a molecular weight of 411.40 g/mol. Its IUPAC name is [(5S,7R)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(5S,7R)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 1126903 |
| Molecular Formula | C19H21F4N5O |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | [(5S,7R)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](c2ccc(F)cc2)N3)CC1 |
| InChI | InChI=1S/C19H21F4N5O/c1-26-6-8-27(9-7-26)18(29)15-11-17-24-14(12-2-4-13(20)5-3-12)10-16(19(21,22)23)28(17)25-15/h2-5,11,14,16,24H,6-10H2,1H3/t14-,16+/m0/s1 |
| InChIKey | KJCNWIBVQCNNPG-GOEBONIOSA-N |
| XLogP | 3.07 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |