C28H33F4N5O — CID 135896457
[4-(1-adamantyl)piperazin-1-yl]-[(5R,7S)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 135896457) has the molecular formula C28H33F4N5O and a molecular weight of 531.60 g/mol. Its IUPAC name is [4-(1-adamantyl)piperazin-1-yl]-[(5R,7S)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [4-(1-adamantyl)piperazin-1-yl]-[(5R,7S)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 135896457 |
| Molecular Formula | C28H33F4N5O |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | [4-(1-adamantyl)piperazin-1-yl]-[(5R,7S)-5-(4-fluorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1cc2n(n1)[C@H](C(F)(F)F)C[C@H](c1ccc(F)cc1)N2)N1CCN(C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C28H33F4N5O/c29-21-3-1-20(2-4-21)22-12-24(28(30,31)32)37-25(33-22)13-23(34-37)26(38)35-5-7-36(8-6-35)27-14-17-9-18(15-27)11-19(10-17)16-27/h1-4,13,17-19,22,24,33H,5-12,14-16H2/t17?,18?,19?,22-,24+,27?/m1/s1 |
| InChIKey | SMXGJCRSRYGRBF-XZNUUDFLSA-N |
| XLogP | 5.41 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |