C33H39N5O — CID 135896448
[4-(1-adamantyl)piperazin-1-yl]-[(5R,7R)-5,7-diphenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 135896448) has the molecular formula C33H39N5O and a molecular weight of 521.71 g/mol. Its IUPAC name is [4-(1-adamantyl)piperazin-1-yl]-[(5R,7R)-5,7-diphenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [4-(1-adamantyl)piperazin-1-yl]-[(5R,7R)-5,7-diphenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 135896448 |
| Molecular Formula | C33H39N5O |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | [4-(1-adamantyl)piperazin-1-yl]-[(5R,7R)-5,7-diphenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1cc2n(n1)[C@@H](c1ccccc1)C[C@H](c1ccccc1)N2)N1CCN(C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C33H39N5O/c39-32(36-11-13-37(14-12-36)33-20-23-15-24(21-33)17-25(16-23)22-33)29-19-31-34-28(26-7-3-1-4-8-26)18-30(38(31)35-29)27-9-5-2-6-10-27/h1-10,19,23-25,28,30,34H,11-18,20-22H2/t23?,24?,25?,28-,30-,33?/m1/s1 |
| InChIKey | OWUINTCBNUFMTE-UFHJSVPCSA-N |
| XLogP | 5.76 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |