C30H38F3N5O3 — CID 4917119
[4-(1-adamantyl)piperazin-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 4917119) has the molecular formula C30H38F3N5O3 and a molecular weight of 573.66 g/mol. Its IUPAC name is [4-(1-adamantyl)piperazin-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [4-(1-adamantyl)piperazin-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 4917119 |
| Molecular Formula | C30H38F3N5O3 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | [4-(1-adamantyl)piperazin-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | COc1ccc(C2CC(C(F)(F)F)n3nc(C(=O)N4CCN(C56CC7CC(CC(C7)C5)C6)CC4)cc3N2)cc1OC |
| InChI | InChI=1S/C30H38F3N5O3/c1-40-24-4-3-21(12-25(24)41-2)22-13-26(30(31,32)33)38-27(34-22)14-23(35-38)28(39)36-5-7-37(8-6-36)29-15-18-9-19(16-29)11-20(10-18)17-29/h3-4,12,14,18-20,22,26,34H,5-11,13,15-17H2,1-2H3 |
| InChIKey | AYVCODBACZNFIJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |