C30H39F3N5O3+ — CID 3670883
[4-(2-adamantyl)piperazin-4-ium-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 3670883) has the molecular formula C30H39F3N5O3+ and a molecular weight of 574.67 g/mol. Its IUPAC name is [4-(2-adamantyl)piperazin-4-ium-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | [4-(2-adamantyl)piperazin-4-ium-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 3670883 |
| Molecular Formula | C30H39F3N5O3+ |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | [4-(2-adamantyl)piperazin-4-ium-1-yl]-[5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | COc1ccc(C2CC(C(F)(F)F)n3nc(C(=O)N4CC[NH+](C5C6CC7CC(C6)CC5C7)CC4)cc3N2)cc1OC |
| InChI | InChI=1S/C30H38F3N5O3/c1-40-24-4-3-19(14-25(24)41-2)22-15-26(30(31,32)33)38-27(34-22)16-23(35-38)29(39)37-7-5-36(6-8-37)28-20-10-17-9-18(12-20)13-21(28)11-17/h3-4,14,16-18,20-22,26,28,34H,5-13,15H2,1-2H3/p+1 |
| InChIKey | COUQSWZIKUJZCY-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |