C22H20ClF3N4O3 — CID 136853509
(5R,7S)-N-(2-chlorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136853509) has the molecular formula C22H20ClF3N4O3 and a molecular weight of 480.87 g/mol. Its IUPAC name is (5R,7S)-N-(2-chlorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-N-(2-chlorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136853509 |
| Molecular Formula | C22H20ClF3N4O3 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (5R,7S)-N-(2-chlorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)Nc4ccccc4Cl)cc3N2)cc1OC |
| InChI | InChI=1S/C22H20ClF3N4O3/c1-32-17-8-7-12(9-18(17)33-2)15-10-19(22(24,25)26)30-20(27-15)11-16(29-30)21(31)28-14-6-4-3-5-13(14)23/h3-9,11,15,19,27H,10H2,1-2H3,(H,28,31)/t15-,19+/m1/s1 |
| InChIKey | LVFLAGQWYLUHLN-BEFAXECRSA-N |
| XLogP | 5.47 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |