C25H25F3N4O3 — CID 136853465
(5R,7S)-N-(2,3-dihydro-1H-inden-5-yl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136853465) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is (5R,7S)-N-(2,3-dihydro-1H-inden-5-yl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-N-(2,3-dihydro-1H-inden-5-yl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136853465 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (5R,7S)-N-(2,3-dihydro-1H-inden-5-yl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)Nc4ccc5c(c4)CCC5)cc3N2)cc1OC |
| InChI | InChI=1S/C25H25F3N4O3/c1-34-20-9-7-16(11-21(20)35-2)18-12-22(25(26,27)28)32-23(30-18)13-19(31-32)24(33)29-17-8-6-14-4-3-5-15(14)10-17/h6-11,13,18,22,30H,3-5,12H2,1-2H3,(H,29,33)/t18-,22+/m1/s1 |
| InChIKey | CPQCLIJFAYCFKZ-GCJKJVERSA-N |
| XLogP | 5.30 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |