C20H19I — CID 11269169
1-[(Z)-(3-tert-butylcyclopenta-2,4-dien-1-ylidene)methyl]-8-iodonaphthalene (PubChem CID 11269169) has the molecular formula C20H19I and a molecular weight of 386.28 g/mol. Its IUPAC name is 1-[(Z)-(3-tert-butylcyclopenta-2,4-dien-1-ylidene)methyl]-8-iodonaphthalene.
| Compound Name | 1-[(Z)-(3-tert-butylcyclopenta-2,4-dien-1-ylidene)methyl]-8-iodonaphthalene |
|---|---|
| PubChem CID | 11269169 |
| Molecular Formula | C20H19I |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 1-[(Z)-(3-tert-butylcyclopenta-2,4-dien-1-ylidene)methyl]-8-iodonaphthalene |
| SMILES | CC(C)(C)C1=C/C(=C\c2cccc3cccc(I)c23)C=C1 |
| InChI | InChI=1S/C20H19I/c1-20(2,3)17-11-10-14(13-17)12-16-8-4-6-15-7-5-9-18(21)19(15)16/h4-13H,1-3H3/b14-12- |
| InChIKey | YOVLFLVWWBFTMC-OWBHPGMISA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|