C20H21NO5S — CID 11269210
(3S)-1-hydroxy-3-[7-methoxy-1-(4-methylphenyl)sulfonylindol-4-yl]butan-2-one (PubChem CID 11269210) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is (3S)-1-hydroxy-3-[7-methoxy-1-(4-methylphenyl)sulfonylindol-4-yl]butan-2-one.
| Compound Name | (3S)-1-hydroxy-3-[7-methoxy-1-(4-methylphenyl)sulfonylindol-4-yl]butan-2-one |
|---|---|
| PubChem CID | 11269210 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (3S)-1-hydroxy-3-[7-methoxy-1-(4-methylphenyl)sulfonylindol-4-yl]butan-2-one |
| SMILES | COc1ccc([C@H](C)C(=O)CO)c2ccn(S(=O)(=O)c3ccc(C)cc3)c12 |
| InChI | InChI=1S/C20H21NO5S/c1-13-4-6-15(7-5-13)27(24,25)21-11-10-17-16(14(2)18(23)12-22)8-9-19(26-3)20(17)21/h4-11,14,22H,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | OFLMPLKSRKFXNJ-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |