C20H20IN3O3S — CID 129265153
4-[2-(2-hydroxyethylamino)-1-iodoethyl]-1-(4-methylphenyl)sulfonylindole-7-carbonitrile (PubChem CID 129265153) has the molecular formula C20H20IN3O3S and a molecular weight of 509.37 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethylamino)-1-iodoethyl]-1-(4-methylphenyl)sulfonylindole-7-carbonitrile.
| Compound Name | 4-[2-(2-hydroxyethylamino)-1-iodoethyl]-1-(4-methylphenyl)sulfonylindole-7-carbonitrile |
|---|---|
| PubChem CID | 129265153 |
| Molecular Formula | C20H20IN3O3S |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | 4-[2-(2-hydroxyethylamino)-1-iodoethyl]-1-(4-methylphenyl)sulfonylindole-7-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(C(I)CNCCO)ccc(C#N)c32)cc1 |
| InChI | InChI=1S/C20H20IN3O3S/c1-14-2-5-16(6-3-14)28(26,27)24-10-8-18-17(19(21)13-23-9-11-25)7-4-15(12-22)20(18)24/h2-8,10,19,23,25H,9,11,13H2,1H3 |
| InChIKey | OYSJZNMGFLGNTA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|