C13H10BrF2NOS — CID 112696487
N-[(3-bromothiophen-2-yl)methyl]-2,4-difluoro-5-methylbenzamide (PubChem CID 112696487) has the molecular formula C13H10BrF2NOS and a molecular weight of 346.20 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2,4-difluoro-5-methylbenzamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2,4-difluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 112696487 |
| Molecular Formula | C13H10BrF2NOS |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2,4-difluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCc2sccc2Br)c(F)cc1F |
| InChI | InChI=1S/C13H10BrF2NOS/c1-7-4-8(11(16)5-10(7)15)13(18)17-6-12-9(14)2-3-19-12/h2-5H,6H2,1H3,(H,17,18) |
| InChIKey | MLSFKJANRNJMDH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |