C13H12BrNO3S — CID 78986095
N-[(3-bromothiophen-2-yl)methyl]-2-hydroxy-5-methoxybenzamide (PubChem CID 78986095) has the molecular formula C13H12BrNO3S and a molecular weight of 342.21 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2-hydroxy-5-methoxybenzamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 78986095 |
| Molecular Formula | C13H12BrNO3S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2-hydroxy-5-methoxybenzamide |
| SMILES | COc1ccc(O)c(C(=O)NCc2sccc2Br)c1 |
| InChI | InChI=1S/C13H12BrNO3S/c1-18-8-2-3-11(16)9(6-8)13(17)15-7-12-10(14)4-5-19-12/h2-6,16H,7H2,1H3,(H,15,17) |
| InChIKey | DSSBIPOKEBENCY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |