C11H11BrN4O2S — CID 112697264
3-bromo-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-5-nitropyridin-2-amine (PubChem CID 112697264) has the molecular formula C11H11BrN4O2S and a molecular weight of 343.21 g/mol. Its IUPAC name is 3-bromo-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-5-nitropyridin-2-amine.
| Compound Name | 3-bromo-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 112697264 |
| Molecular Formula | C11H11BrN4O2S |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 3-bromo-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]-5-nitropyridin-2-amine |
| SMILES | Cc1cnc(C(C)Nc2ncc([N+](=O)[O-])cc2Br)s1 |
| InChI | InChI=1S/C11H11BrN4O2S/c1-6-4-14-11(19-6)7(2)15-10-9(12)3-8(5-13-10)16(17)18/h3-5,7H,1-2H3,(H,13,15) |
| InChIKey | HWXLIXRIBQBIJW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|