C10H13BrN2O3S — CID 112697409
N-(5-bromo-4-methyl-2-pyridinyl)-2-methylsulfonylpropanamide (PubChem CID 112697409) has the molecular formula C10H13BrN2O3S and a molecular weight of 321.20 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-2-methylsulfonylpropanamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 112697409 |
| Molecular Formula | C10H13BrN2O3S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-methylsulfonylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)S(C)(=O)=O)ncc1Br |
| InChI | InChI=1S/C10H13BrN2O3S/c1-6-4-9(12-5-8(6)11)13-10(14)7(2)17(3,15)16/h4-5,7H,1-3H3,(H,12,13,14) |
| InChIKey | YADAVYSQHIYWFT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |