C10H12N2O5S — CID 113421841
6-(2-methylsulfonylpropanoylamino)pyridine-3-carboxylic acid (PubChem CID 113421841) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is 6-(2-methylsulfonylpropanoylamino)pyridine-3-carboxylic acid.
| Compound Name | 6-(2-methylsulfonylpropanoylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 113421841 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-(2-methylsulfonylpropanoylamino)pyridine-3-carboxylic acid |
| SMILES | CC(C(=O)Nc1ccc(C(=O)O)cn1)S(C)(=O)=O |
| InChI | InChI=1S/C10H12N2O5S/c1-6(18(2,16)17)9(13)12-8-4-3-7(5-11-8)10(14)15/h3-6H,1-2H3,(H,14,15)(H,11,12,13) |
| InChIKey | BVKBQNMHRTVNOY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |