C16H17N3O7S — CID 87419927
6-[(2-methylsulfonyloxy-6-propan-2-yloxypyridine-4-carbonyl)amino]pyridine-3-carboxylic acid (PubChem CID 87419927) has the molecular formula C16H17N3O7S and a molecular weight of 395.39 g/mol. Its IUPAC name is 6-[(2-methylsulfonyloxy-6-propan-2-yloxypyridine-4-carbonyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[(2-methylsulfonyloxy-6-propan-2-yloxypyridine-4-carbonyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 87419927 |
| Molecular Formula | C16H17N3O7S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 6-[(2-methylsulfonyloxy-6-propan-2-yloxypyridine-4-carbonyl)amino]pyridine-3-carboxylic acid |
| SMILES | CC(C)Oc1cc(C(=O)Nc2ccc(C(=O)O)cn2)cc(OS(C)(=O)=O)n1 |
| InChI | InChI=1S/C16H17N3O7S/c1-9(2)25-13-6-11(7-14(19-13)26-27(3,23)24)15(20)18-12-5-4-10(8-17-12)16(21)22/h4-9H,1-3H3,(H,21,22)(H,17,18,20) |
| InChIKey | SRQAXPZHTLEYFJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|