C20H16F4N4O2 — CID 1126981
(5S,7S)-5-(4-fluorophenyl)-N-(3-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1126981) has the molecular formula C20H16F4N4O2 and a molecular weight of 420.37 g/mol. Its IUPAC name is (5S,7S)-5-(4-fluorophenyl)-N-(3-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-5-(4-fluorophenyl)-N-(3-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1126981 |
| Molecular Formula | C20H16F4N4O2 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (5S,7S)-5-(4-fluorophenyl)-N-(3-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(O)c1)c1cnn2c1N[C@H](c1ccc(F)cc1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C20H16F4N4O2/c21-12-6-4-11(5-7-12)16-9-17(20(22,23)24)28-18(27-16)15(10-25-28)19(30)26-13-2-1-3-14(29)8-13/h1-8,10,16-17,27,29H,9H2,(H,26,30)/t16-,17-/m0/s1 |
| InChIKey | WFFOLPFLWDPYPC-IRXDYDNUSA-N |
| XLogP | 4.64 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |