C21H17F4N5O4 — CID 3133791
5-(4-fluorophenyl)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 3133791) has the molecular formula C21H17F4N5O4 and a molecular weight of 479.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 3133791 |
| Molecular Formula | C21H17F4N5O4 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cnn3c2NC(c2ccc(F)cc2)CC3C(F)(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17F4N5O4/c1-34-15-7-13(6-14(8-15)30(32)33)27-20(31)16-10-26-29-18(21(23,24)25)9-17(28-19(16)29)11-2-4-12(22)5-3-11/h2-8,10,17-18,28H,9H2,1H3,(H,27,31) |
| InChIKey | QQDILAOUAITARW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|