C24H24F3N5O7 — CID 1368830
(5S,7R)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1368830) has the molecular formula C24H24F3N5O7 and a molecular weight of 551.48 g/mol. Its IUPAC name is (5S,7R)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7R)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1368830 |
| Molecular Formula | C24H24F3N5O7 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | (5S,7R)-N-(3-methoxy-5-nitrophenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cnn3c2N[C@H](c2cc(OC)c(OC)c(OC)c2)C[C@@H]3C(F)(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24F3N5O7/c1-36-15-8-13(7-14(9-15)32(34)35)29-23(33)16-11-28-31-20(24(25,26)27)10-17(30-22(16)31)12-5-18(37-2)21(39-4)19(6-12)38-3/h5-9,11,17,20,30H,10H2,1-4H3,(H,29,33)/t17-,20+/m0/s1 |
| InChIKey | ROPMILJZRFXRJB-FXAWDEMLSA-N |
| XLogP | 4.74 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|