C25H27F3N4O4 — CID 1127578
(5S,7S)-N-(2-ethylphenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1127578) has the molecular formula C25H27F3N4O4 and a molecular weight of 504.51 g/mol. Its IUPAC name is (5S,7S)-N-(2-ethylphenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-N-(2-ethylphenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1127578 |
| Molecular Formula | C25H27F3N4O4 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (5S,7S)-N-(2-ethylphenyl)-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cnn2c1N[C@H](c1cc(OC)c(OC)c(OC)c1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C25H27F3N4O4/c1-5-14-8-6-7-9-17(14)31-24(33)16-13-29-32-21(25(26,27)28)12-18(30-23(16)32)15-10-19(34-2)22(36-4)20(11-15)35-3/h6-11,13,18,21,30H,5,12H2,1-4H3,(H,31,33)/t18-,21-/m0/s1 |
| InChIKey | XPKIEHFUOSKKIY-RXVVDRJESA-N |
| XLogP | 5.38 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |