C25H27F3N4O5 — CID 136695617
(5R,7R)-N-[4-[(1S)-1-hydroxyethyl]phenyl]-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136695617) has the molecular formula C25H27F3N4O5 and a molecular weight of 520.51 g/mol. Its IUPAC name is (5R,7R)-N-[4-[(1S)-1-hydroxyethyl]phenyl]-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7R)-N-[4-[(1S)-1-hydroxyethyl]phenyl]-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136695617 |
| Molecular Formula | C25H27F3N4O5 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | (5R,7R)-N-[4-[(1S)-1-hydroxyethyl]phenyl]-7-(trifluoromethyl)-5-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1cc([C@H]2C[C@H](C(F)(F)F)n3ncc(C(=O)Nc4ccc([C@H](C)O)cc4)c3N2)cc(OC)c1OC |
| InChI | InChI=1S/C25H27F3N4O5/c1-13(33)14-5-7-16(8-6-14)30-24(34)17-12-29-32-21(25(26,27)28)11-18(31-23(17)32)15-9-19(35-2)22(37-4)20(10-15)36-3/h5-10,12-13,18,21,31,33H,11H2,1-4H3,(H,30,34)/t13-,18+,21+/m0/s1 |
| InChIKey | TWHFVTXZZJWQBI-WMHILYHISA-N |
| XLogP | 4.87 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |