C23H19F3N2O2 — CID 11269901
N-(4-amino-2-benzoylphenyl)-3-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 11269901) has the molecular formula C23H19F3N2O2 and a molecular weight of 412.41 g/mol. Its IUPAC name is N-(4-amino-2-benzoylphenyl)-3-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(4-amino-2-benzoylphenyl)-3-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 11269901 |
| Molecular Formula | C23H19F3N2O2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(4-amino-2-benzoylphenyl)-3-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | Nc1ccc(NC(=O)CCc2ccccc2C(F)(F)F)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H19F3N2O2/c24-23(25,26)19-9-5-4-6-15(19)10-13-21(29)28-20-12-11-17(27)14-18(20)22(30)16-7-2-1-3-8-16/h1-9,11-12,14H,10,13,27H2,(H,28,29) |
| InChIKey | QVZHJFWVHZYPDY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|