C12H18BrN3O — CID 112699018
2-[(5-bromo-3-methyl-2-pyridinyl)amino]-N,N-diethylacetamide (PubChem CID 112699018) has the molecular formula C12H18BrN3O and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 112699018 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[(5-bromo-3-methyl-2-pyridinyl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNc1ncc(Br)cc1C |
| InChI | InChI=1S/C12H18BrN3O/c1-4-16(5-2)11(17)8-15-12-9(3)6-10(13)7-14-12/h6-7H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | KUICCURRWQLRJN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |