C12H18N4O3 — CID 115658747
N,N-diethyl-2-[(5-methyl-3-nitro-2-pyridinyl)amino]acetamide (PubChem CID 115658747) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N,N-diethyl-2-[(5-methyl-3-nitro-2-pyridinyl)amino]acetamide.
| Compound Name | N,N-diethyl-2-[(5-methyl-3-nitro-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 115658747 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N,N-diethyl-2-[(5-methyl-3-nitro-2-pyridinyl)amino]acetamide |
| SMILES | CCN(CC)C(=O)CNc1ncc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O3/c1-4-15(5-2)11(17)8-14-12-10(16(18)19)6-9(3)7-13-12/h6-7H,4-5,8H2,1-3H3,(H,13,14) |
| InChIKey | KNZJIMOXSIDFBL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|