C9H9BrF2O — CID 112699172
3-(2-bromophenyl)-1,1-difluoropropan-2-ol (PubChem CID 112699172) has the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1,1-difluoropropan-2-ol.
| Compound Name | 3-(2-bromophenyl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 112699172 |
| Molecular Formula | C9H9BrF2O |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 3-(2-bromophenyl)-1,1-difluoropropan-2-ol |
| SMILES | OC(Cc1ccccc1Br)C(F)F |
| InChI | InChI=1S/C9H9BrF2O/c10-7-4-2-1-3-6(7)5-8(13)9(11)12/h1-4,8-9,13H,5H2 |
| InChIKey | MVWKJLCHHWVUBT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |