C10H12BrF2N — CID 84729687
2-[(2-bromophenyl)methyl]-3,3-difluoropropan-1-amine (PubChem CID 84729687) has the molecular formula C10H12BrF2N and a molecular weight of 264.11 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-3,3-difluoropropan-1-amine.
| Compound Name | 2-[(2-bromophenyl)methyl]-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 84729687 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-3,3-difluoropropan-1-amine |
| SMILES | NCC(Cc1ccccc1Br)C(F)F |
| InChI | InChI=1S/C10H12BrF2N/c11-9-4-2-1-3-7(9)5-8(6-14)10(12)13/h1-4,8,10H,5-6,14H2 |
| InChIKey | XWCPRGSVIFGONJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |