About 4-azido-3-nitroquinoline
4-azido-3-nitroquinoline (PubChem CID 112704025) has the molecular formula C9H5N5O2
and a molecular weight of 215.17 g/mol. Its IUPAC name is 4-azido-3-nitroquinoline.
Molecular Properties
| Compound Name | 4-azido-3-nitroquinoline |
| PubChem CID | 112704025 |
| Molecular Formula | C9H5N5O2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 4-azido-3-nitroquinoline |
| SMILES | [N-]=[N+]=Nc1c([N+](=O)[O-])cnc2ccccc12 |
| InChI | InChI=1S/C9H5N5O2/c10-13-12-9-6-3-1-2-4-7(6)11-5-8(9)14(15)16/h1-5H |
| InChIKey | BJVPBGYNTPQSSY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-3-nitroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-3-nitroquinoline?
The IUPAC name of 4-azido-3-nitroquinoline (CID 112704025) is 4-azido-3-nitroquinoline.
What is the SMILES notation for 4-azido-3-nitroquinoline?
The canonical SMILES for 4-azido-3-nitroquinoline is [N-]=[N+]=Nc1c([N+](=O)[O-])cnc2ccccc12.
What is the InChIKey of 4-azido-3-nitroquinoline?
The InChIKey is BJVPBGYNTPQSSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N5O2/c10-13-12-9-6-3-1-2-4-7(6)11-5-8(9)14(15)16/h1-5H.
What are the key properties of 4-azido-3-nitroquinoline?
4-azido-3-nitroquinoline has a molecular weight of 215.17 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-3-nitroquinoline is sourced from PubChem (CID 112704025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).