About 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole
3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole (PubChem CID 112707841) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole.
Analyze 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole (CID 112707841) is 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole is Cc1noc(C2CSCN2)n1.
What is the InChIKey of 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole?
The InChIKey is MLOVUVBJGBAMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c1-4-8-6(10-9-4)5-2-11-3-7-5/h5,7H,2-3H2,1H3.
What are the key properties of 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole?
3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole has a molecular weight of 171.22 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(1,3-thiazolidin-4-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 112707841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).