C8H10N2NaO2S — CID 112708599
CID 112708599 (PubChem CID 112708599) has the molecular formula C8H10N2NaO2S and a molecular weight of 221.24 g/mol.
| Compound Name | CID 112708599 |
|---|---|
| PubChem CID | 112708599 |
| Molecular Formula | C8H10N2NaO2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | — |
| SMILES | CN1CCc2nc(C(=O)O)sc2C1.[Na] |
| InChI | InChI=1S/C8H10N2O2S.Na/c1-10-3-2-5-6(4-10)13-7(9-5)8(11)12;/h2-4H2,1H3,(H,11,12); |
| InChIKey | QMMAZVVALOZTSL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |