C18H20N6OS — CID 166338584
N,5-dimethyl-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 166338584) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is N,5-dimethyl-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N,5-dimethyl-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166338584 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N,5-dimethyl-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N(C)Cc3nc(-c4ccccc4)n[nH]3)sc2C1 |
| InChI | InChI=1S/C18H20N6OS/c1-23-9-8-13-14(10-23)26-17(19-13)18(25)24(2)11-15-20-16(22-21-15)12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3,(H,20,21,22) |
| InChIKey | FCXBJAICAOXPMA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |