About [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine
[1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine (PubChem CID 112709458) has the molecular formula C8H13N5
and a molecular weight of 179.23 g/mol. Its IUPAC name is [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine.
Analyze [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine?
The IUPAC name of [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine (CID 112709458) is [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine.
What is the SMILES notation for [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine?
The canonical SMILES for [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine is NCC1CCCN1c1cncnn1.
What is the InChIKey of [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine?
The InChIKey is YOILFMZWSSHLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5/c9-4-7-2-1-3-13(7)8-5-10-6-11-12-8/h5-7H,1-4,9H2.
What are the key properties of [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine?
[1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine has a molecular weight of 179.23 g/mol, XLogP of -0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,2,4-triazin-6-yl)pyrrolidin-2-yl]methanamine is sourced from PubChem (CID 112709458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).