C19H17F7O5 — CID 11271081
(E)-1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4,4,5,5,5-heptafluoropent-2-en-1-one (PubChem CID 11271081) has the molecular formula C19H17F7O5 and a molecular weight of 458.33 g/mol. Its IUPAC name is (E)-1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4,4,5,5,5-heptafluoropent-2-en-1-one.
| Compound Name | (E)-1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4,4,5,5,5-heptafluoropent-2-en-1-one |
|---|---|
| PubChem CID | 11271081 |
| Molecular Formula | C19H17F7O5 |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (E)-1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4,4,5,5,5-heptafluoropent-2-en-1-one |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)/C(F)=C(\F)C(F)(F)C(F)(F)F)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H17F7O5/c1-17(2)30-14-13(28-8-9-6-4-3-5-7-9)12(29-16(14)31-17)11(27)10(20)15(21)18(22,23)19(24,25)26/h3-7,12-14,16H,8H2,1-2H3/b15-10+/t12-,13+,14-,16-/m1/s1 |
| InChIKey | PLLOHRMWGXPWGM-JKWNSWFBSA-N |
| XLogP | 4.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|