C7H8N2O — CID 112711838
3a,7a-dihydro-1,2-benzoxazol-5-amine (PubChem CID 112711838) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 3a,7a-dihydro-1,2-benzoxazol-5-amine.
| Compound Name | 3a,7a-dihydro-1,2-benzoxazol-5-amine |
|---|---|
| PubChem CID | 112711838 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 3a,7a-dihydro-1,2-benzoxazol-5-amine |
| SMILES | NC1=CC2C=NOC2C=C1 |
| InChI | InChI=1S/C7H8N2O/c8-6-1-2-7-5(3-6)4-9-10-7/h1-5,7H,8H2 |
| InChIKey | KILLFBVESATROH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |