C8H10N2O — CID 112711878
3a,7a-dihydro-1,2-benzoxazol-4-ylmethanamine (PubChem CID 112711878) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3a,7a-dihydro-1,2-benzoxazol-4-ylmethanamine.
| Compound Name | 3a,7a-dihydro-1,2-benzoxazol-4-ylmethanamine |
|---|---|
| PubChem CID | 112711878 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3a,7a-dihydro-1,2-benzoxazol-4-ylmethanamine |
| SMILES | NCC1=CC=CC2ON=CC12 |
| InChI | InChI=1S/C8H10N2O/c9-4-6-2-1-3-8-7(6)5-10-11-8/h1-3,5,7-8H,4,9H2 |
| InChIKey | XOFKJPSCTDYAGC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |