C10H14N2O — CID 112712227
1-(3a,7a-dihydro-1,2-benzoxazol-6-yl)propan-2-amine (PubChem CID 112712227) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(3a,7a-dihydro-1,2-benzoxazol-6-yl)propan-2-amine.
| Compound Name | 1-(3a,7a-dihydro-1,2-benzoxazol-6-yl)propan-2-amine |
|---|---|
| PubChem CID | 112712227 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-(3a,7a-dihydro-1,2-benzoxazol-6-yl)propan-2-amine |
| SMILES | CC(N)CC1=CC2ON=CC2C=C1 |
| InChI | InChI=1S/C10H14N2O/c1-7(11)4-8-2-3-9-6-12-13-10(9)5-8/h2-3,5-7,9-10H,4,11H2,1H3 |
| InChIKey | GAFCJVGCXBXOPX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |