C22H30ClN3O4Si — CID 11271220
1-[4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylphenyl]-3-[(2-chloro-5-nitrophenyl)methyl]urea (PubChem CID 11271220) has the molecular formula C22H30ClN3O4Si and a molecular weight of 464.04 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylphenyl]-3-[(2-chloro-5-nitrophenyl)methyl]urea.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylphenyl]-3-[(2-chloro-5-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 11271220 |
| Molecular Formula | C22H30ClN3O4Si |
| Molecular Weight | 464.04 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylphenyl]-3-[(2-chloro-5-nitrophenyl)methyl]urea |
| SMILES | Cc1cc(O[Si](C)(C)C(C)(C)C)cc(C)c1NC(=O)NCc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H30ClN3O4Si/c1-14-10-18(30-31(6,7)22(3,4)5)11-15(2)20(14)25-21(27)24-13-16-12-17(26(28)29)8-9-19(16)23/h8-12H,13H2,1-7H3,(H2,24,25,27) |
| InChIKey | QNYLNBSWFFHQKK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.04 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|