C18H18ClIN4O — CID 11271332
3-(3-chloro-2-pyridinyl)-N-(4-iodophenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 11271332) has the molecular formula C18H18ClIN4O and a molecular weight of 468.73 g/mol. Its IUPAC name is 3-(3-chloro-2-pyridinyl)-N-(4-iodophenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | 3-(3-chloro-2-pyridinyl)-N-(4-iodophenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 11271332 |
| Molecular Formula | C18H18ClIN4O |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 3-(3-chloro-2-pyridinyl)-N-(4-iodophenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)N1C2CCC1CN(c1ncccc1Cl)C2 |
| InChI | InChI=1S/C18H18ClIN4O/c19-16-2-1-9-21-17(16)23-10-14-7-8-15(11-23)24(14)18(25)22-13-5-3-12(20)4-6-13/h1-6,9,14-15H,7-8,10-11H2,(H,22,25) |
| InChIKey | YYQLTRKQTUCTAL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|