methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate

C11H18N2O2 — CID 112713844

IUPACmethyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate
SMILESCOC(=O)c1c(C)cc(C(C)CN)n1C
InChIInChI=1S/C11H18N2O2/c1-7-5-9(8(2)6-12)13(3)10(7)11(14)15-4/h5,8H,6,12H2,1-4H3
InChIKeyVSLNPJRGHQTSMA-UHFFFAOYSA-N
MW210.28 g/mol
LogP1.18
Rot. Bonds3

About methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate

methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate (PubChem CID 112713844) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate
PubChem CID112713844
Molecular FormulaC11H18N2O2
Molecular Weight210.28 g/mol
Exact Mass210.14
IUPAC Namemethyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate
SMILESCOC(=O)c1c(C)cc(C(C)CN)n1C
InChIInChI=1S/C11H18N2O2/c1-7-5-9(8(2)6-12)13(3)10(7)11(14)15-4/h5,8H,6,12H2,1-4H3
InChIKeyVSLNPJRGHQTSMA-UHFFFAOYSA-N
XLogP1.18
TPSA57.25 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.28
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate?
The IUPAC name of methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate (CID 112713844) is methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate.
What is the SMILES notation for methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate?
The canonical SMILES for methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate is COC(=O)c1c(C)cc(C(C)CN)n1C.
What is the InChIKey of methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate?
The InChIKey is VSLNPJRGHQTSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-7-5-9(8(2)6-12)13(3)10(7)11(14)15-4/h5,8H,6,12H2,1-4H3.
What are the key properties of methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate?
methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate has a molecular weight of 210.28 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1-aminopropan-2-yl)-1,3-dimethylpyrrole-2-carboxylate is sourced from PubChem (CID 112713844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).