About methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate
methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate (PubChem CID 112709807) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate.
Analyze methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate?
The IUPAC name of methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate (CID 112709807) is methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate.
What is the SMILES notation for methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate?
The canonical SMILES for methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate is COC(=O)c1c(C)cc(C)n1CCO.
What is the InChIKey of methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate?
The InChIKey is VMHUMRGIPXRQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-7-6-8(2)11(4-5-12)9(7)10(13)14-3/h6,12H,4-5H2,1-3H3.
What are the key properties of methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate?
methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate has a molecular weight of 197.23 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-hydroxyethyl)-3,5-dimethylpyrrole-2-carboxylate is sourced from PubChem (CID 112709807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).