C9H14N2O4 — CID 2783724
1,3-bis(2-hydroxyethyl)-6-methylpyrimidine-2,4-dione (PubChem CID 2783724) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1,3-bis(2-hydroxyethyl)-6-methylpyrimidine-2,4-dione.
| Compound Name | 1,3-bis(2-hydroxyethyl)-6-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2783724 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1,3-bis(2-hydroxyethyl)-6-methylpyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(CCO)c(=O)n1CCO |
| InChI | InChI=1S/C9H14N2O4/c1-7-6-8(14)11(3-5-13)9(15)10(7)2-4-12/h6,12-13H,2-5H2,1H3 |
| InChIKey | AAAPIPDCURLSDL-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |