About 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine
3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine (PubChem CID 112715017) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine.
Molecular Properties
| Compound Name | 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine |
| PubChem CID | 112715017 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine |
| SMILES | CC1Cc2c(c(C3CC3)nn2C)C1N |
| InChI | InChI=1S/C11H17N3/c1-6-5-8-9(10(6)12)11(7-3-4-7)13-14(8)2/h6-7,10H,3-5,12H2,1-2H3 |
| InChIKey | KEAIJXMWYMGRQP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine?
The IUPAC name of 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine (CID 112715017) is 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine.
What is the SMILES notation for 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine?
The canonical SMILES for 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine is CC1Cc2c(c(C3CC3)nn2C)C1N.
What is the InChIKey of 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine?
The InChIKey is KEAIJXMWYMGRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-6-5-8-9(10(6)12)11(7-3-4-7)13-14(8)2/h6-7,10H,3-5,12H2,1-2H3.
What are the key properties of 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine?
3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine has a molecular weight of 191.28 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1,5-dimethyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-amine is sourced from PubChem (CID 112715017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).