6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid

C10H14N2O2 — CID 112715288

IUPAC6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid
SMILESCC1(C)CCc2cn[nH]c2C1C(=O)O
InChIInChI=1S/C10H14N2O2/c1-10(2)4-3-6-5-11-12-8(6)7(10)9(13)14/h5,7H,3-4H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyXMTCHDTYTJMXEL-UHFFFAOYSA-N
MW194.23 g/mol
LogP1.55
Rot. Bonds1

About 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid

6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid (PubChem CID 112715288) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid.

Molecular Properties

Compound Name6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid
PubChem CID112715288
Molecular FormulaC10H14N2O2
Molecular Weight194.23 g/mol
Exact Mass194.11
IUPAC Name6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid
SMILESCC1(C)CCc2cn[nH]c2C1C(=O)O
InChIInChI=1S/C10H14N2O2/c1-10(2)4-3-6-5-11-12-8(6)7(10)9(13)14/h5,7H,3-4H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyXMTCHDTYTJMXEL-UHFFFAOYSA-N
XLogP1.55
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 51.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid?
The IUPAC name of 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid (CID 112715288) is 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid.
What is the SMILES notation for 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid?
The canonical SMILES for 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid is CC1(C)CCc2cn[nH]c2C1C(=O)O.
What is the InChIKey of 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid?
The InChIKey is XMTCHDTYTJMXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-10(2)4-3-6-5-11-12-8(6)7(10)9(13)14/h5,7H,3-4H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid?
6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid has a molecular weight of 194.23 g/mol, XLogP of 1.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1,4,5,7-tetrahydroindazole-7-carboxylic acid is sourced from PubChem (CID 112715288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).