C10H17N3O — CID 112715391
4-(aminomethyl)-5,5-dimethyl-6,7-dihydro-1H-indazol-4-ol (PubChem CID 112715391) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-(aminomethyl)-5,5-dimethyl-6,7-dihydro-1H-indazol-4-ol.
| Compound Name | 4-(aminomethyl)-5,5-dimethyl-6,7-dihydro-1H-indazol-4-ol |
|---|---|
| PubChem CID | 112715391 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-(aminomethyl)-5,5-dimethyl-6,7-dihydro-1H-indazol-4-ol |
| SMILES | CC1(C)CCc2[nH]ncc2C1(O)CN |
| InChI | InChI=1S/C10H17N3O/c1-9(2)4-3-8-7(5-12-13-8)10(9,14)6-11/h5,14H,3-4,6,11H2,1-2H3,(H,12,13) |
| InChIKey | IKUOTIKWYLYWFQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |