C11H19N3O — CID 83909377
4-(2-aminoethyl)-3-ethyl-1,5,6,7-tetrahydroindazol-4-ol (PubChem CID 83909377) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3-ethyl-1,5,6,7-tetrahydroindazol-4-ol.
| Compound Name | 4-(2-aminoethyl)-3-ethyl-1,5,6,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 83909377 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-(2-aminoethyl)-3-ethyl-1,5,6,7-tetrahydroindazol-4-ol |
| SMILES | CCc1n[nH]c2c1C(O)(CCN)CCC2 |
| InChI | InChI=1S/C11H19N3O/c1-2-8-10-9(14-13-8)4-3-5-11(10,15)6-7-12/h15H,2-7,12H2,1H3,(H,13,14) |
| InChIKey | ZDGFCSLMBXYCEW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |